Difference between revisions of "CPD-9956"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPGPL FPGPL] == * direction: ** REVERSIBLE * common name: ** D-Fructose 1-phosphate D-glyceraldehyd...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPGPL FPGPL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4101 CPD-4101] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
 
* common name:
 
* common name:
−
** D-Fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase
+
** 24-methylenelophenol
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-methyl-5α-ergosta-7,24-dien-3β-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[2.1.1.143-RXN]]
−
** 1.0 [[D-fructofuranose-1-phosphate]][h] '''<=>''' 1.0 [[GLYCERALD]][h] '''+''' 1.0 [[DIHYDROXY-ACETONE-PHOSPHATE]][h]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 D-fructofuranose 1-phosphate[h] '''<=>''' 1.0 D-glyceraldehyde[h] '''+''' 1.0 glycerone phosphate[h]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_65]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=D-Fructose 1-phosphate D-glyceraldehyde-3-phosphate-lyase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283640 5283640]
−
{{#set: gene associated=Tiso_gene_65}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29107 29107]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11522 C11522]
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N}}
 +
{{#set: common name=24-methylenelophenol}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: common name=4&alpha;-methyl-5&alpha;-ergosta-7,24-dien-3&beta;-ol}}
 +
{{#set: consumed by=2.1.1.143-RXN}}

Revision as of 16:48, 10 January 2018

Metabolite CPD-4101

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=RSMKYRDCCSNYFM-AAGDOFLISA-N
  • common name:
    • 24-methylenelophenol
  • molecular weight:
    • 412.698
  • Synonym(s):
    • 4α-methyl-5α-ergosta-7,24-dien-3β-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-9956&oldid=14709"