Difference between revisions of "Tiso gene 18542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15036 RXN-15036] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15036 RXN-15036] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.23 EC-2.3.1.23]
+
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
 +
* common name:
 +
** 5'-hydroxycotinine
 +
* molecular weight:
 +
** 192.217   
 
* Synonym(s):
 
* Synonym(s):
 +
** allohydroxycotinine
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-8355]][c] '''+''' 1 [[OLEOYL-COA]][c] '''<=>''' 1 [[CPD-8291]][c] '''+''' 1 [[CO-A]][c]
+
* [[RXN66-163]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 1-18:1-2-lysophosphatidylethanolamine[c] '''+''' 1 oleoyl-CoA[c] '''<=>''' 1 1-18:1-2-18:1-phosphatidylethanolamine[c] '''+''' 1 coenzyme A[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_10604]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7409]], phospholipid remodeling (phosphatidylethanolamine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7409 PWY-7409]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[experimental_annotation]]
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.3.1.23}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9815515 9815515]
−
{{#set: gene associated=Tiso_gene_10604}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-7409}}
+
** [http://www.chemspider.com/Chemical-Structure.7991265.html 7991265]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB01427
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=5'-hydroxycotinine}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=192.217    }}
−
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
+
{{#set: common name=allohydroxycotinine}}
 +
{{#set: produced by=RXN66-163}}

Revision as of 17:49, 10 January 2018

Metabolite CPD-2751

  • smiles:
    • C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
  • inchi key:
    • InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
  • common name:
    • 5'-hydroxycotinine
  • molecular weight:
    • 192.217
  • Synonym(s):
    • allohydroxycotinine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18542&oldid=14779"