Difference between revisions of "Tiso gene 18263"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] == * smiles: ** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_IODINE-MOLECULE TransportSeed_IODINE-MOLECULE] == * direction: ** LEFT-TO-RIGHT * Syn...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14925 CPD-14925] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_IODINE-MOLECULE TransportSeed_IODINE-MOLECULE] ==
* smiles:
+
* direction:
** CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J
+
* common name:
+
** 3-cis-decenoyl-CoA
+
* molecular weight:
+
** 915.738   
+
 
* Synonym(s):
 
* Synonym(s):
** (3Z)-dec-3-enoyl-CoA
 
** 10:1(n-7)-CoA
 
** 10:1-Δ3-CoA
 
** (3Z)-decenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-17799]]
+
** 1.0 [[IODINE-MOLECULE]][e] '''=>''' 1.0 [[IODINE-MOLECULE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 I2[e] '''=>''' 1.0 I2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659267 90659267]
+
{{#set: in pathway=}}
{{#set: smiles=CCCCCCC=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reconstruction category=manual}}
{{#set: inchi key=InChIKey=CQGVNMQHZQJNII-UUSBZYPOSA-J}}
+
{{#set: reconstruction source=added to manage seeds from extracellular to cytosol compartment}}
{{#set: common name=3-cis-decenoyl-CoA}}
+
{{#set: molecular weight=915.738    }}
+
{{#set: common name=(3Z)-dec-3-enoyl-CoA|10:1(n-7)-CoA|10:1-Δ3-CoA|(3Z)-decenoyl-CoA}}
+
{{#set: produced by=RXN-17799}}
+

Revision as of 16:49, 10 January 2018

Reaction TransportSeed_IODINE-MOLECULE

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links