Difference between revisions of "Tiso gene 19787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * smiles: ** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O * inchi key:...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_IODINE-MOLECULE ExchangeSeed_IODINE-MOLECULE] == * direction: ** REVERSIBLE * Synonym(...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_IODINE-MOLECULE ExchangeSeed_IODINE-MOLECULE] ==
* smiles:
+
* direction:
** CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O
+
** REVERSIBLE
* inchi key:
+
** InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N
+
* common name:
+
** 4-hydroxy-2-nonenal-[Cys-Gly] conjugate
+
* molecular weight:
+
** 334.43   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13677]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[IODINE-MOLECULE]][C-BOUNDARY] '''<=>''' 1.0 [[IODINE-MOLECULE]][e]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 I2[C-BOUNDARY] '''<=>''' 1.0 I2[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[manual]]:
 +
** [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659346 90659346]
+
{{#set: in pathway=}}
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC([N+])C(=O)NCC([O-])=O}}
+
{{#set: reconstruction category=manual}}
{{#set: inchi key=InChIKey=LQTWZQSULMRBEE-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=added to manage seeds from boundary to extracellular compartment}}
{{#set: common name=4-hydroxy-2-nonenal-[Cys-Gly] conjugate}}
+
{{#set: molecular weight=334.43    }}
+
{{#set: consumed by=RXN-13677}}
+

Revision as of 16:49, 10 January 2018

Reaction ExchangeSeed_IODINE-MOLECULE

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links