Difference between revisions of "L-PANTOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCERALD GLYCERALD] == * smiles: ** [CH](=O)C(O)CO * inchi key: ** InChIKey=MNQZXJOMYWMBOU-VKH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == * smiles: ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16954 CPD-16954] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K |
* common name: | * common name: | ||
| − | ** | + | ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 380.17 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15733]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657876 90657876] |
| − | + | {{#set: smiles=CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}} | |
| − | + | {{#set: inchi key=InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K}} | |
| − | + | {{#set: common name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate}} | |
| − | + | {{#set: molecular weight=380.17 }} | |
| − | + | {{#set: produced by=RXN-15733}} | |
| − | + | ||
| − | + | ||
| − | {{#set: smiles=[ | + | |
| − | {{#set: inchi key=InChIKey= | + | |
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:49, 10 January 2018
Contents
Metabolite CPD-16954
- smiles:
- CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
- inchi key:
- InChIKey=PJDXUYNCNWFPCZ-IUYQGCFVSA-K
- common name:
- [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate
- molecular weight:
- 380.17
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC2(C(C(C)OP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))" cannot be used as a page name in this wiki.
"1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate" cannot be used as a page name in this wiki.
