Difference between revisions of "Tiso gene 787"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] == * smiles: ** CC([N+])C([O-])=O * inchi key: ** InChIKey=QNAYBMKLOCPYGJ-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == |
* smiles: | * smiles: | ||
| − | ** CC([ | + | ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J |
* common name: | * common name: | ||
| − | ** | + | ** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1069.99 |
* Synonym(s): | * Synonym(s): | ||
| + | ** (3R)-hydroxy-20:2Δ11,14 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16096]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16095]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408] |
| − | + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | {{#set: smiles=CC([ | + | {{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}} |
| − | {{#set: common name= | + | {{#set: molecular weight=1069.99 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=(3R)-hydroxy-20:2Δ11,14}} |
| − | {{#set: | + | {{#set: consumed by=RXN-16096}} |
| − | {{#set: | + | {{#set: produced by=RXN-16095}} |
Revision as of 16:49, 10 January 2018
Contents
Metabolite CPD-17347
- smiles:
- CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
- common name:
- (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
- molecular weight:
- 1069.99
- Synonym(s):
- (3R)-hydroxy-20:2Δ11,14
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
