Difference between revisions of "L-methionyl-L-seryl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=6MPURt 6MPURt] == * direction: ** REVERSIBLE * common name: ** nucleobase transport, 6-mercaptopuri...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=6MPURt 6MPURt] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
 +
* inchi key:
 +
** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
 
* common name:
 
* common name:
−
** nucleobase transport, 6-mercaptopurine (extracellular)
+
** (S)-equol 4'-sulfate
 +
* molecular weight:
 +
** 321.324   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4',7-isoflavandiol 4'-sulfate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[Thiopurines]][e] '''<=>''' 1.0 [[Thiopurines]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-15589]]
−
** 1.0 a thiopurine[e] '''<=>''' 1.0 a thiopurine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18556]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_6578]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_18433]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=nucleobase transport, 6-mercaptopurine (extracellular)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373]
−
{{#set: gene associated=Tiso_gene_18556|Tiso_gene_6578|Tiso_gene_18433}}
+
{{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=(S)-equol 4'-sulfate}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=321.324    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: common name=4',7-isoflavandiol 4'-sulfate}}
 +
{{#set: consumed or produced by=RXN-15589}}

Revision as of 16:50, 10 January 2018

Metabolite CPD-16825

  • smiles:
    • C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
  • inchi key:
    • InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
  • common name:
    • (S)-equol 4'-sulfate
  • molecular weight:
    • 321.324
  • Synonym(s):
    • 4',7-isoflavandiol 4'-sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-methionyl-L-seryl-Protein&oldid=14884"