Difference between revisions of "CPD1G-1346"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10625 RXN-10625] == * direction: ** LEFT-TO-RIGHT * common name: ** geranylgeranyl_diphosphate_...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * smiles: ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O |
| + | * inchi key: | ||
| + | ** InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-3-hydroxyvaleryl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 863.619 |
* Synonym(s): | * Synonym(s): | ||
| + | ** D-β-hydroxyvaleryl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-12560]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758578 54758578] |
| − | + | {{#set: smiles=CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O}} | |
| − | + | {{#set: inchi key=InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J}} | |
| − | {{#set: | + | {{#set: common name=(R)-3-hydroxyvaleryl-CoA}} |
| − | + | {{#set: molecular weight=863.619 }} | |
| − | + | {{#set: common name=D-β-hydroxyvaleryl-CoA}} | |
| − | + | {{#set: consumed or produced by=RXN-12560}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:51, 10 January 2018
Contents
Metabolite CPD-13533
- smiles:
- CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O
- inchi key:
- InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J
- common name:
- (R)-3-hydroxyvaleryl-CoA
- molecular weight:
- 863.619
- Synonym(s):
- D-β-hydroxyvaleryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O" cannot be used as a page name in this wiki.
