Difference between revisions of "RXN-17878"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11878 CPD-11878] == * smiles: ** C(O)C(O)C1(C=CC(O)=C(O)C=1) * inchi key: ** InChIKey=MTVWF...") |
(Created page with "Category:Gene == Gene Tiso_gene_5715 == * left end position: ** 10289 * transcription direction: ** POSITIVE * right end position: ** 12421 * centisome position: ** 78.885...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_5715 == |
− | * | + | * left end position: |
− | ** | + | ** 10289 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 12421 |
− | * | + | * centisome position: |
− | ** | + | ** 78.88523 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.4.11.18-RXN]] | |
− | * [[RXN- | + | ** in-silico_annotation |
− | == | + | ***automated-name-match |
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | * [[RXN-17873]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17874]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17875]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17876]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17877]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | * [[RXN-17878]] | ||
+ | ** in-silico_annotation | ||
+ | ***automated-name-match | ||
+ | ** experimental_annotation | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7799]] | ||
+ | * [[PWY-7800]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=10289}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=12421}} | |
− | + | {{#set: centisome position=78.88523 }} | |
− | + | {{#set: reaction associated=3.4.11.18-RXN|RXN-17873|RXN-17874|RXN-17875|RXN-17876|RXN-17877|RXN-17878}} | |
− | + | {{#set: pathway associated=PWY-7799|PWY-7800}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:51, 10 January 2018
Gene Tiso_gene_5715
- left end position:
- 10289
- transcription direction:
- POSITIVE
- right end position:
- 12421
- centisome position:
- 78.88523
- Synonym(s):
Reactions associated
- 3.4.11.18-RXN
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- pantograph-esiliculosus
- in-silico_annotation
- RXN-17873
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- RXN-17874
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- RXN-17875
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- RXN-17876
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- RXN-17877
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation
- RXN-17878
- in-silico_annotation
- automated-name-match
- experimental_annotation
- automated-name-match
- in-silico_annotation