Difference between revisions of "RXN-9526"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_15839 == * left end position: ** 2153 * transcription direction: ** NEGATIVE * right end position: ** 4007 * centisome position: ** 45.1457...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15839 == |
− | * | + | * left end position: |
− | ** | + | ** 2153 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4007 |
− | * | + | * centisome position: |
− | ** | + | ** 45.145733 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[PRTRANS-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[athaliana]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[TRPSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2153}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4007}} | |
− | + | {{#set: centisome position=45.145733 }} | |
− | + | {{#set: reaction associated=PRTRANS-RXN}} | |
− | + | {{#set: pathway associated=TRPSYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:51, 10 January 2018
Gene Tiso_gene_15839
- left end position:
- 2153
- transcription direction:
- NEGATIVE
- right end position:
- 4007
- centisome position:
- 45.145733
- Synonym(s):
Reactions associated
- PRTRANS-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-athaliana
- pantograph-synechocystis
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation