Difference between revisions of "Tiso gene 4677"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-564 CPD-564] == * smiles: ** C(CC([N+])C(=O)[O-])SCC1(OC(O)C(O)C(O)1) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene Tiso_gene_7215 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** pantograph-athaliana * ATPSYN-RXN ** in-silico_annotation...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7215 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[ATPASE-RXN]] | |
− | * [[ | + | ** [[pantograph]]-[[athaliana]] |
− | == | + | * [[ATPSYN-RXN]] |
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=ATPASE-RXN|ATPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:51, 10 January 2018
Gene Tiso_gene_7215
- Synonym(s):
Reactions associated
- ATPASE-RXN
- ATPSYN-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation