Difference between revisions of "CPD-12853"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] == * smiles: ** C(=O)([O-])C([N+])C(O)COP([O...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHmi ALCDHmi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogenase (ethanol:...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-PHOSPHONOOXY-THREONINE 4-PHOSPHONOOXY-THREONINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDHmi ALCDHmi] ==
−
* smiles:
+
* direction:
−
** C(=O)([O-])C([N+])C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FKHAKIJOKDGEII-GBXIJSLDSA-L
+
 
* common name:
 
* common name:
−
** 4-phospho-hydroxy-L-threonine
+
** alcohol dehydrogenase (ethanol: NAD), mitochondrial
−
* molecular weight:
+
−
** 213.083   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-threo-3-hydroxy-homoserine phosphate
 
−
** 4-phosphonooxy-L-threonine
 
−
** 4-phospho-hydroxy-threonine
 
−
** 4-(phosphonooxy)-threonine
 
−
** O-phospho-4-hydroxy-L-threonine
 
−
** phospho-hydroxy-threonine
 
−
** 4-(phosphonooxy)-L-threonine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14125]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ACETALD]][m] '''+''' 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m] '''=>''' 1.0 [[NAD]][m] '''+''' 1.0 [[ETOH]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PSERTRANSAMPYR-RXN]]
+
** 1.0 acetaldehyde[m] '''+''' 1.0 NADH[m] '''+''' 1.0 H+[m] '''=>''' 1.0 NAD+[m] '''+''' 1.0 ethanol[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2052]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06055 C06055]
+
{{#set: common name=alcohol dehydrogenase (ethanol: NAD), mitochondrial}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_2052}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58452 58452]
+
{{#set: in pathway=}}
−
* BIGG : phthr
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480653 45480653]
+
{{#set: reconstruction source=creinhardtii}}
−
* HMDB : HMDB06802
+
−
{{#set: smiles=C(=O)([O-])C([N+])C(O)COP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FKHAKIJOKDGEII-GBXIJSLDSA-L}}
+
−
{{#set: common name=4-phospho-hydroxy-L-threonine}}
+
−
{{#set: molecular weight=213.083    }}
+
−
{{#set: common name=L-threo-3-hydroxy-homoserine phosphate|4-phosphonooxy-L-threonine|4-phospho-hydroxy-threonine|4-(phosphonooxy)-threonine|O-phospho-4-hydroxy-L-threonine|phospho-hydroxy-threonine|4-(phosphonooxy)-L-threonine}}
+
−
{{#set: consumed by=RXN-14125}}
+
−
{{#set: consumed or produced by=PSERTRANSAMPYR-RXN}}
+

Revision as of 16:52, 10 January 2018

Reaction ALCDHmi

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • alcohol dehydrogenase (ethanol: NAD), mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetaldehyde[m] + 1.0 NADH[m] + 1.0 H+[m] => 1.0 NAD+[m] + 1.0 ethanol[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12853&oldid=15063"