Difference between revisions of "RXN-17797"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14085 == * left end position: ** 2082 * transcription direction: ** NEGATIVE * right end position: ** 4742 * centisome position: ** 35.5411...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] ==
+
== Gene Tiso_gene_14085 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
** 2082
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** UDP-α-D-galacturonate
+
** 4742
−
* molecular weight:
+
* centisome position:
−
** 577.265    
+
** 35.54114    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[UDPGALor]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
+
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2082}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244587 25244587]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=4742}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57635 57635]
+
{{#set: centisome position=35.54114   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00617 C00617]
+
−
* HMDB : HMDB12302
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
−
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K}}
+
−
{{#set: common name=UDP-α-D-galacturonate}}
+
−
{{#set: molecular weight=577.265   }}
+
−
{{#set: produced by=UDPGALor}}
+
−
{{#set: consumed or produced by=UDP-GLUCURONATE-4-EPIMERASE-RXN}}
+

Revision as of 16:52, 10 January 2018

Gene Tiso_gene_14085

  • left end position:
    • 2082
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4742
  • centisome position:
    • 35.54114
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17797&oldid=15071"