Difference between revisions of "Tiso gene 15962"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HG0 HG0] == * smiles: ** [Hg] * inchi key: ** InChIKey=QSHDDOUJBYECFT-UHFFFAOYSA-N * common nam...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** CC(=O)NC(C([O-])=O)CC[CH]=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M |
* common name: | * common name: | ||
| − | ** | + | ** N-acetyl-L-glutamate 5-semialdehyde |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 172.16 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-acetylglutamate γ-semialdehyde |
| − | ** | + | ** N-acetyl-L-glutamate-5-semialdehyde |
| − | ** | + | ** N-acetyl-L-glutamate semialdehyde |
| − | ** | + | ** N-acetylglutamate semialdehyde |
| + | ** 2-acetamido-5-oxopentanoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[N-ACETYLGLUTPREDUCT-RXN]] | ||
| + | * [[ACETYLORNTRANSAM-RXN]] | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC29123 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857435 6857435] |
| + | * HMDB : HMDB06488 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01250 C01250] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5256773.html 5256773] |
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29123 29123] |
| − | * | + | * BIGG : acg5sa |
| − | + | {{#set: smiles=CC(=O)NC(C([O-])=O)CC[CH]=O}} | |
| − | {{#set: smiles=[ | + | {{#set: inchi key=InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=N-acetyl-L-glutamate 5-semialdehyde}} |
| − | {{#set: common name= | + | {{#set: molecular weight=172.16 }} |
| − | {{#set: molecular weight= | + | {{#set: common name=N-acetylglutamate γ-semialdehyde|N-acetyl-L-glutamate-5-semialdehyde|N-acetyl-L-glutamate semialdehyde|N-acetylglutamate semialdehyde|2-acetamido-5-oxopentanoate}} |
| − | {{#set: common name= | + | {{#set: consumed or produced by=N-ACETYLGLUTPREDUCT-RXN|ACETYLORNTRANSAM-RXN}} |
| − | {{#set: produced by= | + | |
Revision as of 16:53, 10 January 2018
Contents
Metabolite CPD-469
- smiles:
- CC(=O)NC(C([O-])=O)CC[CH]=O
- inchi key:
- InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M
- common name:
- N-acetyl-L-glutamate 5-semialdehyde
- molecular weight:
- 172.16
- Synonym(s):
- N-acetylglutamate γ-semialdehyde
- N-acetyl-L-glutamate-5-semialdehyde
- N-acetyl-L-glutamate semialdehyde
- N-acetylglutamate semialdehyde
- 2-acetamido-5-oxopentanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC29123
- PUBCHEM:
- HMDB : HMDB06488
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : acg5sa
"CC(=O)NC(C([O-])=O)CC[CH]=O" cannot be used as a page name in this wiki.
