Difference between revisions of "ACSERLY-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine N-terminal-L-cysteine] == * common name: ** an N-terminal L-cysteinyl-[pr...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] == * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP] == |
| + | * smiles: | ||
| + | ** CC1(N=C(N)C(=CN=1)COP(OP([O-])([O-])=O)([O-])=O) | ||
| + | * inchi key: | ||
| + | ** InChIKey=AGQJQCFEPUVXNK-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine |
| + | * molecular weight: | ||
| + | ** 296.093 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-methyl-4-amino-5-hydroxymethylpyrimidine diphosphate |
| + | ** HMP-PP | ||
| + | ** 4-amino-5-hydroxymethyl-2-methylpyrimidine-PP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[THI-P-SYN-RXN]] |
| − | * [[RXN- | + | * [[RXN-12610]] |
| + | * [[RXN-12611]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[PYRIMSYN3-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 745-65-3 |
| − | {{#set: common name= | + | * CAS : 841-01-0 |
| − | {{#set: consumed by=RXN- | + | * PUBCHEM: |
| − | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245586 25245586] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57841 57841] | ||
| + | * BIGG : 2mahmp | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04752 C04752] | ||
| + | {{#set: smiles=CC1(N=C(N)C(=CN=1)COP(OP([O-])([O-])=O)([O-])=O)}} | ||
| + | {{#set: inchi key=InChIKey=AGQJQCFEPUVXNK-UHFFFAOYSA-K}} | ||
| + | {{#set: common name=4-amino-2-methyl-5-(diphosphomethyl)pyrimidine}} | ||
| + | {{#set: molecular weight=296.093 }} | ||
| + | {{#set: common name=2-methyl-4-amino-5-hydroxymethylpyrimidine diphosphate|HMP-PP|4-amino-5-hydroxymethyl-2-methylpyrimidine-PP}} | ||
| + | {{#set: consumed by=THI-P-SYN-RXN|RXN-12610|RXN-12611}} | ||
| + | {{#set: produced by=PYRIMSYN3-RXN}} | ||
Revision as of 16:54, 10 January 2018
Contents
Metabolite AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP
- smiles:
- CC1(N=C(N)C(=CN=1)COP(OP([O-])([O-])=O)([O-])=O)
- inchi key:
- InChIKey=AGQJQCFEPUVXNK-UHFFFAOYSA-K
- common name:
- 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine
- molecular weight:
- 296.093
- Synonym(s):
- 2-methyl-4-amino-5-hydroxymethylpyrimidine diphosphate
- HMP-PP
- 4-amino-5-hydroxymethyl-2-methylpyrimidine-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=C(N)C(=CN=1)COP(OP([O-])([O-])=O)([O-])=O)" cannot be used as a page name in this wiki.
