Difference between revisions of "CPD-335"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-BUTYRALDEHYDE 4-AMINO-BUTYRALDEHYDE] == * smiles: ** C(C[N+])CC=O * inchi key: ** InChI...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == |
* smiles: | * smiles: | ||
− | ** C(C[ | + | ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L |
* common name: | * common name: | ||
− | ** | + | ** β-L-arabinose 1-phosphate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 228.095 |
* Synonym(s): | * Synonym(s): | ||
− | + | ** β-L-arabinose 1-P | |
− | ** & | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[UMPU]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(C[ | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB12195 |
− | {{#set: common name= | + | {{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}} |
− | {{#set: common name= | + | {{#set: common name=β-L-arabinose 1-phosphate}} |
− | + | {{#set: molecular weight=228.095 }} | |
− | {{#set: consumed | + | {{#set: common name=β-L-arabinose 1-P}} |
+ | {{#set: consumed by=UMPU}} |
Revision as of 16:54, 10 January 2018
Contents
Metabolite CPD-1825
- smiles:
- C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
- inchi key:
- InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
- common name:
- β-L-arabinose 1-phosphate
- molecular weight:
- 228.095
- Synonym(s):
- β-L-arabinose 1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.