Difference between revisions of "Tiso gene 4484"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** thymidine_phosphorylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[Pi]][c] '''+''' 1 [[MALTOHEXAOSE]][c] '''=>''' 1 [[MALTOPENTAOSE]][c] '''+''' 1 [[GLC-1-P]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 phosphate[c] '''+''' 1 maltohexaose[c] '''=>''' 1 maltopentaose[c] '''+''' 1 α-D-glucopyranose 1-phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_1011]] | ||
+ | ** IN-SILICO_ANNOTATION | ||
+ | ***EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * [[annotation]]: | ||
+ | ** [[pathwaytools]]: | ||
+ | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=thymidine_phosphorylase}} | |
− | + | {{#set: ec number=EC-2.4.1.1}} | |
− | + | {{#set: gene associated=Tiso_gene_1011}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | {{#set: reconstruction source=in-silico_annotation}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:54, 10 January 2018
Contents
Reaction RXN-14285
- direction:
- LEFT-TO-RIGHT
- common name:
- thymidine_phosphorylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Pi[c] + 1 MALTOHEXAOSE[c] => 1 MALTOPENTAOSE[c] + 1 GLC-1-P[c]
- With common name(s):
- 1 phosphate[c] + 1 maltohexaose[c] => 1 maltopentaose[c] + 1 α-D-glucopyranose 1-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_1011
- IN-SILICO_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION