Difference between revisions of "Tiso gene 1007"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-7α-hydroxykaur-16...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE-6P TREHALOSE-6P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-160 RXN1F-160] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L
+
 
* common name:
 
* common name:
−
** α,α-trehalose 6-phosphate
+
** ent-7α-hydroxykaur-16-en-19-oate monooxygenase
−
* molecular weight:
+
−
** 420.263   
+
 
* Synonym(s):
 
* Synonym(s):
−
** α,α-D-trehalose 6-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[TREHALOSEPHOSPHA-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD1F-136]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD1F-138]][c] '''+''' 1 [[NADP]][c]
−
* [[UG6PGT]]
+
* With common name(s):
−
* [[UG6PGTn]]
+
** 1 ent-7α-hydroxykaur-16-en-19-oate[c] '''+''' 1 oxygen[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 2 H2O[c] '''+''' 1 gibberellin A12-aldehyde[c] '''+''' 1 NADP+[c]
−
* [[TREHALOSE6PSYN-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3577]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_8263]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
 +
** '''6''' reactions found over '''15''' reactions in the full pathway
 +
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 
== External links  ==
 
== External links  ==
−
* CAS : 4484-88-2
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=22904 22904]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246105 25246105]
+
* LIGAND-RXN:
−
* HMDB : HMDB01124
+
** [http://www.genome.jp/dbget-bin/www_bget?R06295 R06295]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00689 C00689]
+
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate monooxygenase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3577|Tiso_gene_8263}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58429 58429]
+
{{#set: in pathway=PWY-5047|PWY-5034}}
−
* BIGG : tre6p
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)COP([O-])(=O)[O-])O)O)O)))O}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=LABSPYBHMPDTEL-LIZSDCNHSA-L}}
+
{{#set: reconstruction source=esiliculosus}}
−
{{#set: common name=α,α-trehalose 6-phosphate}}
+
−
{{#set: molecular weight=420.263    }}
+
−
{{#set: common name=α,α-D-trehalose 6-phosphate}}
+
−
{{#set: consumed by=TREHALOSEPHOSPHA-RXN}}
+
−
{{#set: produced by=UG6PGT|UG6PGTn|TREHALOSE6PSYN-RXN}}
+

Revision as of 16:54, 10 January 2018

Reaction RXN1F-160

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ent-7α-hydroxykaur-16-en-19-oate monooxygenase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 ent-7α-hydroxykaur-16-en-19-oate[c] + 1 oxygen[c] + 1 NADPH[c] + 1 H+[c] => 2 H2O[c] + 1 gibberellin A12-aldehyde[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5047, gibberellin biosynthesis IV (Gibberella fujikuroi): PWY-5047
    • 6 reactions found over 15 reactions in the full pathway
  • PWY-5034, GA12 biosynthesis: PWY-5034
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1007&oldid=15234"