Difference between revisions of "RXN-15740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == * smiles: ** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_1916 == * left end position: ** 14487 * transcription direction: ** NEGATIVE * right end position: ** 15179 * centisome position: ** 57.584...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] ==
+
== Gene Tiso_gene_1916 ==
* smiles:
+
* left end position:
** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 14487
* inchi key:
+
* transcription direction:
** InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
+
** NEGATIVE
* common name:
+
* right end position:
** 3-cis, 5-trans-dodecadienoyl-CoA
+
** 15179
* molecular weight:
+
* centisome position:
** 941.776    
+
** 57.584072    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* [[ATPASE-RXN]]
* [[RXN-14799]]
+
** in-silico_annotation
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: left end position=14487}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657300 90657300]
+
{{#set: transcription direction=NEGATIVE}}
{{#set: smiles=CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=15179}}
{{#set: inchi key=InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J}}
+
{{#set: centisome position=57.584072   }}
{{#set: common name=3-cis, 5-trans-dodecadienoyl-CoA}}
+
{{#set: reaction associated=ATPASE-RXN}}
{{#set: molecular weight=941.776   }}
+
{{#set: produced by=RXN-14799}}
+

Revision as of 16:55, 10 January 2018

Gene Tiso_gene_1916

  • left end position:
    • 14487
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 15179
  • centisome position:
    • 57.584072
  • Synonym(s):

Reactions associated

Pathways associated

External links