Difference between revisions of "CPD-15688"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_1590 == * left end position: ** 11529 * transcription direction: ** POSITIVE * right end position: ** 12065 * centisome position: ** 50.034...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EPISTEROL EPISTEROL] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N |
| − | * | + | * common name: |
| − | ** | + | ** episterol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 398.671 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN3O-218]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23724571 23724571] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50586 50586] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15777 C15777] |
| + | * HMDB : HMDB06847 | ||
| + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))}} | ||
| + | {{#set: inchi key=InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N}} | ||
| + | {{#set: common name=episterol}} | ||
| + | {{#set: molecular weight=398.671 }} | ||
| + | {{#set: consumed by=RXN3O-218}} | ||
Revision as of 16:55, 10 January 2018
Contents
Metabolite EPISTEROL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))
- inchi key:
- InChIKey=BTCAEOLDEYPGGE-LPWCLQGBSA-N
- common name:
- episterol
- molecular weight:
- 398.671
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1C2CCC(C)34))))" cannot be used as a page name in this wiki.
