Difference between revisions of "CPD0-1162"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBAZOLEPHOSPHAT-RXN RIBAZOLEPHOSPHAT-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** plast...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBAZOLEPHOSPHAT-RXN RIBAZOLEPHOSPHAT-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** plastid_phosphoglycerate_mutase_protein |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.73 EC-3.1.3.73] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[ALPHA-RIBAZOLE-5-P]][c] '''=>''' 1 [[ALPHA-RIBAZOLE]][c] '''+''' 1 [[Pi]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 α-ribazole 5'-phosphate[c] '''=>''' 1 α-ribazole[c] '''+''' 1 phosphate[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_16271]] | ||
| + | ** IN-SILICO_ANNOTATION | ||
| + | ***EC-NUMBER | ||
| + | == Pathways == | ||
| + | * [[PWY-5508]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508] | ||
| + | ** '''3''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24456 24456] |
| − | {{#set: | + | * LIGAND-RXN: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04594 R04594] |
| − | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
| − | {{#set: | + | {{#set: common name=plastid_phosphoglycerate_mutase_protein}} |
| − | {{#set: | + | {{#set: ec number=EC-3.1.3.73}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_16271}} |
| + | {{#set: in pathway=PWY-5508}} | ||
| + | {{#set: reconstruction category=annotation}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
| + | {{#set: reconstruction source=in-silico_annotation}} | ||
Revision as of 16:56, 10 January 2018
Contents
Reaction RIBAZOLEPHOSPHAT-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- plastid_phosphoglycerate_mutase_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 ALPHA-RIBAZOLE-5-P[c] => 1 ALPHA-RIBAZOLE[c] + 1 Pi[c]
- With common name(s):
- 1 H2O[c] + 1 α-ribazole 5'-phosphate[c] => 1 α-ribazole[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_16271
- IN-SILICO_ANNOTATION
- EC-NUMBER
- IN-SILICO_ANNOTATION
Pathways
- PWY-5508, adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: PWY-5508
- 3 reactions found over 9 reactions in the full pathway
Reconstruction information
External links
