Difference between revisions of "CPD-7003"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] == * common name: ** a uridine13 in tRNA * Synonym(s): ** a tRNA...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-uridine13 tRNA-uridine13] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** chlorophyll b
+
** a uridine13 in tRNA
* molecular weight:
+
** 907.486   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a tRNA uridine13
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11841]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7674]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a uridine13 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11593175 11593175]
+
{{#set: common name=a tRNA uridine13}}
* CHEBI:
+
{{#set: consumed by=RXN-11841}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27888 27888]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C05307 C05307]
+
* HMDB : HMDB31146
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyll b}}
+
{{#set: molecular weight=907.486    }}
+
{{#set: produced by=RXN-7674}}
+

Revision as of 16:56, 10 January 2018

Metabolite tRNA-uridine13

  • common name:
    • a uridine13 in tRNA
  • Synonym(s):
    • a tRNA uridine13

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links