Difference between revisions of "CPD-10269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] == * common name: ** a 2-hydroxy carboxylate * S...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == |
+ | * smiles: | ||
+ | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** gibberellin A29 |
+ | * molecular weight: | ||
+ | ** 347.387 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** GA29 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-113]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096] | ||
+ | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}} | ||
+ | {{#set: common name=gibberellin A29}} | ||
+ | {{#set: molecular weight=347.387 }} | ||
+ | {{#set: common name=GA29}} | ||
+ | {{#set: produced by=RXN-113}} |
Revision as of 16:56, 10 January 2018
Contents
Metabolite CPD-236
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
- inchi key:
- InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
- common name:
- gibberellin A29
- molecular weight:
- 347.387
- Synonym(s):
- GA29
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.