Difference between revisions of "RXN-15044"

Revision as of 16:57, 10 January 2018

"a malonyl-[acp] methyl ester" cannot be used as a page name in this wiki.

"a malonyl-[acyl-carrier protein] methyl ester" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] ==
-* smiles:
-** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
-* inchi key:
-** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
 * common name:
-** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
+** a malonyl-[acp] methyl ester
-* molecular weight:
-** 450.508
 * Synonym(s):
+** a malonyl-[acyl-carrier protein] methyl ester
 == Reaction(s) known to consume the compound ==
-* [[RXN-16118]]
+* [[RXN-11474]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a malonyl-[acp] methyl ester}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233]
+{{#set: common name=a malonyl-[acyl-carrier protein] methyl ester}}
-{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}}
+{{#set: consumed by=RXN-11474}}
-{{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}}
-{{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}}
-{{#set: molecular weight=450.508    }}
-{{#set: consumed by=RXN-16118}}