Difference between revisions of "ATDAM"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] == * direction: ** LEFT-TO-RIGHT * common name: ** cystathionine beta-lyase *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15131 RXN-15131] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
+
 
* common name:
 
* common name:
** 1-18:1-2-18:1-phosphatidylethanolamine
+
** cystathionine beta-lyase
* molecular weight:
+
** 744.043   
+
 
* Synonym(s):
 
* Synonym(s):
** phosphatidylethanolamine (1-18:1-2-18:1)
 
** 18:1-18:1-PE
 
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15067]]
+
* With identifiers:
* [[PE1819Z1819Zt]]
+
** 1 [[L-CYSTATHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[HOMO-CYS]][c] '''+''' 1 [[2-AMINOACRYLATE]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[PE1819Z1819Zt]]
+
** 1 L-cystathionine[c] '''=>''' 1 H+[c] '''+''' 1 L-homocysteine[c] '''+''' 1 2-aminoprop-2-enoate[c]
== Reaction(s) of unknown directionality ==
+
 
* [[RXN-15036]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_3732]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-702]], L-methionine biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-702 PWY-702]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-801]], L-homocysteine and L-cysteine interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-801 PWY-801]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[HOMOSER-METSYN-PWY]], L-methionine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
+
{{#set: common name=cystathionine beta-lyase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_3732}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
+
{{#set: in pathway=PWY-702|PWY-801|HOMOSER-METSYN-PWY}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
+
{{#set: reconstruction source=experimental_annotation}}
{{#set: molecular weight=744.043    }}
+
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
+
{{#set: consumed by=RXN-15067|PE1819Z1819Zt}}
+
{{#set: produced by=PE1819Z1819Zt}}
+
{{#set: consumed or produced by=RXN-15036}}
+

Revision as of 16:57, 10 January 2018

Reaction RXN-15131

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cystathionine beta-lyase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-702, L-methionine biosynthesis II: PWY-702
    • 5 reactions found over 6 reactions in the full pathway
  • PWY-801, L-homocysteine and L-cysteine interconversion: PWY-801
    • 3 reactions found over 3 reactions in the full pathway
  • HOMOSER-METSYN-PWY, L-methionine biosynthesis I: HOMOSER-METSYN-PWY
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links