Difference between revisions of "P3I"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-sulfurylase * ec number...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12720 RXN-12720] == |
| − | + | * direction: | |
| − | + | ** LEFT-TO-RIGHT | |
| − | * | + | |
| − | ** | + | |
* common name: | * common name: | ||
| − | ** | + | ** atp-sulfurylase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.7.7.4 EC-2.7.7.4] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1 [[SELENATE]][c] '''+''' 1 [[ATP]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-13713]][c] '''+''' 1 [[PPI]][c] |
| − | * [[ | + | * With common name(s): |
| − | * [[ | + | ** 1 selenate[c] '''+''' 1 ATP[c] '''+''' 2 H+[c] '''=>''' 1 adenosine 5'-phosphoselenate[c] '''+''' 1 diphosphate[c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * [[Tiso_gene_10254]] | ||
| + | ** IN-SILICO_ANNOTATION | ||
| + | ***AUTOMATED-NAME-MATCH | ||
| + | ** [[pantograph]]-[[athaliana]] | ||
| + | ** [[pantograph]]-[[esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6932]], selenate reduction: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6932 PWY-6932] | ||
| + | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * [[orthology]]: | ||
| + | ** [[pantograph]]: | ||
| + | *** [[esiliculosus]] | ||
| + | *** [[athaliana]] | ||
| + | * [[annotation]]: | ||
| + | ** [[pathwaytools]]: | ||
| + | *** [[in-silico_annotation]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=atp-sulfurylase}} | |
| − | + | {{#set: ec number=EC-2.7.7.4}} | |
| − | + | {{#set: gene associated=Tiso_gene_10254}} | |
| − | + | {{#set: in pathway=PWY-6932}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | {{#set: reconstruction source=esiliculosus|athaliana}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | {{#set: reconstruction source=in-silico_annotation}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 16:57, 10 January 2018
Contents
Reaction RXN-12720
- direction:
- LEFT-TO-RIGHT
- common name:
- atp-sulfurylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 selenate[c] + 1 ATP[c] + 2 H+[c] => 1 adenosine 5'-phosphoselenate[c] + 1 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_10254
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- pantograph-athaliana
- pantograph-esiliculosus
- IN-SILICO_ANNOTATION
