Difference between revisions of "RXN-14193"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] == * direction: ** REVERSIBLE * common name: ** alanine_aminotransferase_mitoc...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13698 RXN-13698] ==
−
* smiles:
+
* direction:
−
** C(=O)(C1(O)(C=CCCC(=O)1))[O-]
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
** alanine_aminotransferase_mitochondrial
−
* molecular weight:
+
** alanine_aminotransferase
−
** 155.13   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.6.1.2 EC-2.6.1.2]
 
* Synonym(s):
 
* Synonym(s):
−
** 6-hydroxy-2-cyclohexen-one-carboxylic acid
 
−
** HCC
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12252]]
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c] '''<=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[GLT]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-oxoglutarate[c] '''+''' 1 L-alanine[c] '''<=>''' 1 pyruvate[c] '''+''' 1 L-glutamate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10957]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_5959]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** EXPERIMENTAL_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7117]], C4 photosynthetic carbon assimilation cycle, PEPCK type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7117 PWY-7117]
 +
** '''7''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-7115]], C4 photosynthetic carbon assimilation cycle, NAD-ME type: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7115 PWY-7115]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[esiliculosus]]
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166]
+
{{#set: common name=alanine_aminotransferase_mitochondrial}}
−
{{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}}
+
{{#set: common name=alanine_aminotransferase}}
−
{{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}}
+
{{#set: ec number=EC-2.6.1.2}}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: gene associated=Tiso_gene_10957|Tiso_gene_5959}}
−
{{#set: molecular weight=155.13    }}
+
{{#set: in pathway=PWY-7117|PWY-7115}}
−
{{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: produced by=RXN-12252}}
+
{{#set: reconstruction tool=pantograph}}
 +
{{#set: reconstruction source=esiliculosus}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction source=experimental_annotation|in-silico_annotation}}

Revision as of 16:57, 10 January 2018

Reaction RXN-13698

  • direction:
    • REVERSIBLE
  • common name:
    • alanine_aminotransferase_mitochondrial
    • alanine_aminotransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7117, C4 photosynthetic carbon assimilation cycle, PEPCK type: PWY-7117
    • 7 reactions found over 10 reactions in the full pathway
  • PWY-7115, C4 photosynthetic carbon assimilation cycle, NAD-ME type: PWY-7115
    • 7 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14193&oldid=15404"