Difference between revisions of "Tiso gene 18559"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.125-RXN 2.4.1.125-RXN] == * direction: ** REVERSIBLE * common name: ** morn_repeat_protein *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * smiles: ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] * inchi key: ** InChIKey=WEZ...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)(C1(O)(C=CCCC(=O)1))[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 6-hydroxy-2-cyclohexen-one-carboxylate |
− | * | + | * molecular weight: |
− | ** | + | ** 155.13 |
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 6-hydroxy-2-cyclohexen-one-carboxylic acid | ||
+ | ** HCC | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-12252]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940166 52940166] |
− | + | {{#set: smiles=C(=O)(C1(O)(C=CCCC(=O)1))[O-]}} | |
− | + | {{#set: inchi key=InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M}} | |
− | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylate}} | |
− | + | {{#set: molecular weight=155.13 }} | |
− | + | {{#set: common name=6-hydroxy-2-cyclohexen-one-carboxylic acid|HCC}} | |
− | + | {{#set: produced by=RXN-12252}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 17:58, 10 January 2018
Contents
Metabolite CPD-13172
- smiles:
- C(=O)(C1(O)(C=CCCC(=O)1))[O-]
- inchi key:
- InChIKey=WEZWWZKUBQCMBL-UHFFFAOYSA-M
- common name:
- 6-hydroxy-2-cyclohexen-one-carboxylate
- molecular weight:
- 155.13
- Synonym(s):
- 6-hydroxy-2-cyclohexen-one-carboxylic acid
- HCC
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)(C1(O)(C=CCCC(=O)1))[O-" cannot be used as a page name in this wiki.