Difference between revisions of "RXN-7647"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7647 RXN-7647] == * direction: ** LEFT-TO-RIGHT * common name: ** atp-dependent_rna_helicase_dh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * smiles: ** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7647 RXN-7647] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
 +
* inchi key:
 +
** InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
 
* common name:
 
* common name:
−
** atp-dependent_rna_helicase_dhx30-like
+
** mycophenolic acid O-acyl-glucuronide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/5.5.1.6 EC-5.5.1.6]
+
** 495.459   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-6993]][c] '''=>''' 1 [[CPD-6991]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-13607]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 pinocembrin chalcone[c] '''=>''' 1 (2S)-pinocembrin[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13414]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_9838]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5059]], pinobanksin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07990 R07990]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678773 70678773]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=atp-dependent_rna_helicase_dhx30-like}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66982 66982]
−
{{#set: ec number=EC-5.5.1.6}}
+
{{#set: smiles=CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)}}
−
{{#set: gene associated=Tiso_gene_13414|Tiso_gene_9838}}
+
{{#set: inchi key=InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M}}
−
{{#set: in pathway=PWY-5059}}
+
{{#set: common name=mycophenolic acid O-acyl-glucuronide}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=495.459    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-13607}}
−
{{#set: reconstruction source=esiliculosus}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 16:58, 10 January 2018

Metabolite CPD-14602

  • smiles:
    • CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)
  • inchi key:
    • InChIKey=QBMSTEZXAMABFF-UEARNRKISA-M
  • common name:
    • mycophenolic acid O-acyl-glucuronide
  • molecular weight:
    • 495.459
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(CCC(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(O)2)3))OC)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7647&oldid=15470"