Difference between revisions of "1.13.11.6-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.13.11.6-RXN 1.13.11.6-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyanthranila...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == * smiles: ** C(O)C(=O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=BJHIKXHVC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
+ | * inchi key: | ||
+ | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** keto-D-fructose |
− | * | + | * molecular weight: |
− | ** | + | ** 180.157 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14515]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-7644]] | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] |
− | * | + | * METABOLIGHTS : MTBLC48095 |
− | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} | |
− | {{#set: | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} |
− | {{#set: | + | {{#set: common name=keto-D-fructose}} |
− | {{#set: | + | {{#set: molecular weight=180.157 }} |
− | {{#set: | + | {{#set: consumed by=RXN-14515}} |
− | {{#set: | + | {{#set: consumed or produced by=RXN-7644}} |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 16:58, 10 January 2018
Contents
Metabolite CPD-15382
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
- common name:
- keto-D-fructose
- molecular weight:
- 180.157
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links