Difference between revisions of "R95"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13183 RXN-13183] == * direction: ** REVERSIBLE * common name: ** mitochondrial_l-galactono-_-la...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] == * smiles: ** C(=O)([O-])OP([O-])(=O)O * inchi key: ** InChIKey=LQQCGEGR...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13183 RXN-13183] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18238 CPD-18238] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(=O)([O-])OP([O-])(=O)O
 +
* inchi key:
 +
** InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** mitochondrial_l-galactono-_-lactone_dehydrogenase
+
** carboxyphosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.3.2.3 EC-1.3.2.3]
+
** 139.989   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16910]]
−
** 4 [[Cytochromes-C-Oxidized]][c] '''+''' 1 [[CPD-330]][c] '''<=>''' 4 [[Cytochromes-C-Reduced]][c] '''+''' 4 [[PROTON]][c] '''+''' 1 [[L-DEHYDRO-ASCORBATE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-16909]]
−
** 4 an oxidized c-type cytochrome[c] '''+''' 1 L-galactono-1,4-lactone[c] '''<=>''' 4 a reduced c-type cytochrome[c] '''+''' 4 H+[c] '''+''' 1 L-dehydro-ascorbate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_210]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=mitochondrial_l-galactono-_-lactone_dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826591 91826591]
−
{{#set: ec number=EC-1.3.2.3}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_210}}
+
** [http://www.chemspider.com/Chemical-Structure.169776.html 169776]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86994 86994]
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: smiles=C(=O)([O-])OP([O-])(=O)O}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: inchi key=InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L}}
 +
{{#set: common name=carboxyphosphate}}
 +
{{#set: molecular weight=139.989    }}
 +
{{#set: consumed by=RXN-16910}}
 +
{{#set: produced by=RXN-16909}}

Revision as of 16:58, 10 January 2018

Metabolite CPD-18238

  • smiles:
    • C(=O)([O-])OP([O-])(=O)O
  • inchi key:
    • InChIKey=LQQCGEGRINLHDP-UHFFFAOYSA-L
  • common name:
    • carboxyphosphate
  • molecular weight:
    • 139.989
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])OP([O-])(=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R95&oldid=15534"