Difference between revisions of "Tiso gene 4156"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5838 == * left end position: ** 1939 * transcription direction: ** POSITIVE * right end position: ** 3410 * centisome position: ** 15.06136...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L |
| − | * | + | * common name: |
| − | ** | + | ** β-D-fructofuranose 1-phosphate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| + | ** β-D-fructofuranose-1-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8631]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[KETOHEXOKINASE-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 15978-08-2 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216] |
| − | {{#set: | + | * BIGG : f1p |
| − | {{#set: | + | {{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}} |
| + | {{#set: common name=β-D-fructofuranose 1-phosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=β-D-fructofuranose-1-P}} | ||
| + | {{#set: consumed by=RXN-8631}} | ||
| + | {{#set: produced by=KETOHEXOKINASE-RXN}} | ||
Revision as of 18:00, 10 January 2018
Contents
Metabolite FRU1P
- smiles:
- C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
- inchi key:
- InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
- common name:
- β-D-fructofuranose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- β-D-fructofuranose-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 15978-08-2
- PUBCHEM:
- BIGG : f1p
"C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)" cannot be used as a page name in this wiki.
