Difference between revisions of "Tiso gene 9986"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-144 RXN1F-144] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * inchi key: *...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-144 RXN1F-144] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.5.1.99 EC-2.5.1.99]
+
** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
 +
* common name:
 +
** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
 +
* molecular weight:
 +
** 264.169   
 
* Synonym(s):
 
* Synonym(s):
 +
** cThz-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12610]]
−
** 2 [[GERANYLGERANYL-PP]][c] '''<=>''' 2 [[PPI]][c] '''+''' 1 [[PHYTOENE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 geranylgeranyl diphosphate[c] '''<=>''' 2 diphosphate[c] '''+''' 1 all-trans-phytoene[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15914]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32454 32454]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R07916 R07916]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890]
−
{{#set: direction=REVERSIBLE}}
+
{{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}}
−
{{#set: ec number=EC-2.5.1.99}}
+
{{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}}
−
{{#set: gene associated=Tiso_gene_15914}}
+
{{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=264.169    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=cThz-P}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-12610}}
−
{{#set: reconstruction source=athaliana|esiliculosus}}
+

Revision as of 17:00, 10 January 2018

Metabolite CPD-13576

  • smiles:
    • CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
  • inchi key:
    • InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
  • common name:
    • 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
  • molecular weight:
    • 264.169
  • Synonym(s):
    • cThz-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9986&oldid=15697"