Difference between revisions of "Tiso gene 19791"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * inchi key: ** InChIKey=OCYMERZC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14177 RXN-14177] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
+
** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
 +
* common name:
 +
** 4-methyl-5-(2-phosphooxyethyl)thiazole
 +
* molecular weight:
 +
** 221.167   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
 +
** 4-methyl-5-(2-phosphoethyl)-thiazole
 +
** THZ-P
 +
** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
 +
** HET-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[THI-P-SYN-RXN]]
−
** 1 [[CPD-15152]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-15153]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[THIAZOLSYN3-RXN]]
−
** 1 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 H+[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9109]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_12366]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_20504]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_17244]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_19352]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_13355]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[athaliana]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26465 26465]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: ec number=EC-2.1.1.163}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296]
−
{{#set: gene associated=Tiso_gene_9109|Tiso_gene_12366|Tiso_gene_20504|Tiso_gene_17244|Tiso_gene_19352|Tiso_gene_13355}}
+
* BIGG : 4mpetz
−
{{#set: in pathway=}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}}
−
{{#set: reconstruction source=athaliana}}
+
{{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}}
 +
{{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
 +
{{#set: molecular weight=221.167    }}
 +
{{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}}
 +
{{#set: consumed by=THI-P-SYN-RXN}}
 +
{{#set: produced by=THIAZOLSYN3-RXN}}

Revision as of 17:01, 10 January 2018

Metabolite THZ-P

  • smiles:
    • CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
  • inchi key:
    • InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
  • common name:
    • 4-methyl-5-(2-phosphooxyethyl)thiazole
  • molecular weight:
    • 221.167
  • Synonym(s):
    • 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
    • 4-methyl-5-(2-phosphoethyl)-thiazole
    • THZ-P
    • 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
    • HET-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19791&oldid=15747"