Difference between revisions of "Tiso gene 11797"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTMOHT MTMOHT] == * direction: ** LEFT-TO-RIGHT * common name: ** 5,10-Methylenetetrahydrofolate:3-...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MTMOHT MTMOHT] ==
−
* smiles:
+
* direction:
−
** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
+
 
* common name:
 
* common name:
−
** pinocembrin chalcone
+
** 5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase
−
* molecular weight:
+
−
** 256.257   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7647]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[2-KETO-ISOVALERATE]][m] '''+''' 1.0 [[WATER]][m] '''+''' 1.0 [[METHYLENE-THF]][m] '''=>''' 1.0 [[2-DEHYDROPANTOATE]][m] '''+''' 1.0 [[THF]][m]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 3-methyl-2-oxobutanoate[m] '''+''' 1.0 H2O[m] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] '''=>''' 1.0 2-dehydropantoate[m] '''+''' 1.0 tetrahydropteroyl mono-L-glutamate[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_14465]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[orthology]]:
 +
** [[pantograph]]:
 +
*** [[creinhardtii]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295]
+
{{#set: common name=5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_14465}}
−
** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484]
+
{{#set: reconstruction tool=pantograph}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404]
+
−
{{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}}
+
−
{{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}}
+
−
{{#set: common name=pinocembrin chalcone}}
+
−
{{#set: molecular weight=256.257    }}
+
−
{{#set: consumed by=RXN-7647}}
+

Revision as of 17:02, 10 January 2018

Reaction MTMOHT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 5,10-Methylenetetrahydrofolate:3-methyl-2-oxobutanoate hydroxymethyltransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 3-methyl-2-oxobutanoate[m] + 1.0 H2O[m] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m] => 1.0 2-dehydropantoate[m] + 1.0 tetrahydropteroyl mono-L-glutamate[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_11797&oldid=15784"