Difference between revisions of "Tiso gene 14583"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12479 == * left end position: ** 4714 * transcription direction: ** POSITIVE * right end position: ** 5207 * centisome position: ** 67.7396...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_12479 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
−
* left end position:
+
* smiles:
−
** 4714
+
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
−
* right end position:
+
* common name:
−
** 5207
+
** 8-oxo-dGTP
−
* centisome position:
+
* molecular weight:
−
** 67.73962    
+
** 519.151    
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGTP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[LPLPS1AGPE180]]
+
== Reaction(s) known to produce the compound ==
−
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-11410]]
−
* [[LYSOPHOSPHOLIPASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** in-silico_annotation
+
* [[RXN-14205]]
−
***ec-number
+
−
* [[RXN-15035]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
== Pathways associated ==
+
−
* [[PWY-7409]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4714}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
−
{{#set: right end position=5207}}
+
* CHEBI:
−
{{#set: centisome position=67.73962   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
−
{{#set: reaction associated=LPLPS1AGPE180|LYSOPHOSPHOLIPASE-RXN|RXN-15035}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: pathway associated=PWY-7409}}
+
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
 +
{{#set: common name=8-oxo-dGTP}}
 +
{{#set: molecular weight=519.151   }}
 +
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
 +
{{#set: produced by=RXN-11410}}
 +
{{#set: consumed or produced by=RXN-14205}}

Revision as of 18:02, 10 January 2018

Metabolite CPD0-1905

  • smiles:
    • C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • inchi key:
    • InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
  • common name:
    • 8-oxo-dGTP
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGTP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14583&oldid=15791"