Difference between revisions of "Tiso gene 15276"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12014 CPD-12014] == * smiles: ** CC(=O)NCCC1(=CNC2(C1=CC(OC)=C(O)C=2)) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_7553 == * left end position: ** 3165 * transcription direction: ** NEGATIVE * right end position: ** 5975 * centisome position: ** 28.64253...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7553 == |
− | * | + | * left end position: |
− | ** | + | ** 3165 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5975 |
− | * | + | * centisome position: |
− | ** | + | ** 28.642536 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN0-4261]] |
− | + | ** in-silico_annotation | |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=3165}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5975}} | |
− | + | {{#set: centisome position=28.642536 }} | |
− | + | {{#set: reaction associated=RXN0-4261}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:02, 10 January 2018
Gene Tiso_gene_7553
- left end position:
- 3165
- transcription direction:
- NEGATIVE
- right end position:
- 5975
- centisome position:
- 28.642536
- Synonym(s):
Reactions associated
- RXN0-4261
- in-silico_annotation
- automated-name-match
- in-silico_annotation