Difference between revisions of "Tiso gene 17143"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12872 RXN-12872] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12872 RXN-12872] ==
−
* smiles:
+
* direction:
−
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
+
−
* common name:
+
−
** ent-kaur-16-en-19-oate
+
−
* molecular weight:
+
−
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ent-kaurenoate
 
−
** ent-kaurenoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[1.14.13.79-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-13914]][c] '''=>''' 1 [[CPD-13910]][c]
−
* [[RXN-7580]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 cyclic-2,3-O-oxalyl-L-threonate[c] '''=>''' 1 cyclic- 3,4-O-oxalyl-L-threonate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6960]], L-ascorbate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[in-silico_annotation]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104130004
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: in pathway=PWY-6960}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
+
{{#set: reconstruction category=annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
+
{{#set: reconstruction source=in-silico_annotation}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
+
−
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
+
−
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
+
−
{{#set: common name=ent-kaur-16-en-19-oate}}
+
−
{{#set: molecular weight=301.448    }}
+
−
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
+
−
{{#set: consumed by=1.14.13.79-RXN}}
+
−
{{#set: produced by=RXN-7580}}
+

Revision as of 17:02, 10 January 2018

Reaction RXN-12872

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cyclic-2,3-O-oxalyl-L-threonate[c] => 1 cyclic- 3,4-O-oxalyl-L-threonate[c]

Genes associated with this reaction

Pathways

  • PWY-6960, L-ascorbate degradation III: PWY-6960
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17143&oldid=15838"