Difference between revisions of "RXN0-5224"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE ILE] == * smiles: ** CCC(C)C([N+])C(=O)[O-] * inchi key: ** InChIKey=AGPKZVBTJJNPAG-WHFBIAK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == * smiles: ** C([R])C(=O)CC(=O)[O-] * common name: ** a 3-oxo acid...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-3-OXO-ACID A-3-OXO-ACID] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([R])C(=O)CC(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 3-oxo acid |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-oxy acid |
− | + | ** 3-oxygen acid | |
− | + | ||
− | ** | + | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[3-OXOACID-COA-TRANSFERASE-RXN]] |
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01656 C01656] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47881 47881] |
− | + | {{#set: smiles=C([R])C(=O)CC(=O)[O-]}} | |
− | {{#set: smiles= | + | {{#set: common name=a 3-oxo acid}} |
− | + | {{#set: common name=3-oxy acid|3-oxygen acid}} | |
− | {{#set: common name= | + | {{#set: consumed or produced by=3-OXOACID-COA-TRANSFERASE-RXN}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | + |
Revision as of 18:03, 10 January 2018
Contents
Metabolite A-3-OXO-ACID
- smiles:
- C([R])C(=O)CC(=O)[O-]
- common name:
- a 3-oxo acid
- Synonym(s):
- 3-oxy acid
- 3-oxygen acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([R])C(=O)CC(=O)[O-" cannot be used as a page name in this wiki.