Difference between revisions of "Tiso gene 6457"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Short-RNA-Fragments Short-RNA-Fragments] == * common name: ** a short RNA Segment * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) * inchi key: **...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == |
| + | * smiles: | ||
| + | ** CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2)) | ||
| + | * inchi key: | ||
| + | ** InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** dTMP |
| + | * molecular weight: | ||
| + | ** 320.195 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** thymidylic acid | ||
| + | ** thymidine monophosphate | ||
| + | ** deoxythymidylate | ||
| + | ** TMP | ||
| + | ** thymidine 5'-monophosphate | ||
| + | ** thymidine-phosphate | ||
| + | ** thymidine 5'-phosphate | ||
| + | ** deoxythymidine 5'-phosphate | ||
| + | ** 5'-thymidylic acid | ||
| + | ** deoxythymidylic acid | ||
| + | ** thymidylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DTMPKI-RXN]] | ||
| + | * [[TPH]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[THYMIDYLATESYN-RXN]] | ||
| + | * [[RXN0-5107]] | ||
| + | * [[RXN-14200]] | ||
| + | * [[RXN-14213]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 365-07-1 |
| − | {{#set: consumed | + | * METABOLIGHTS : MTBLC63528 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755631 16755631] | ||
| + | * HMDB : HMDB01227 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00364 C00364] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10239189.html 10239189] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63528 63528] | ||
| + | * BIGG : dtmp | ||
| + | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))}} | ||
| + | {{#set: inchi key=InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L}} | ||
| + | {{#set: common name=dTMP}} | ||
| + | {{#set: molecular weight=320.195 }} | ||
| + | {{#set: common name=thymidylic acid|thymidine monophosphate|deoxythymidylate|TMP|thymidine 5'-monophosphate|thymidine-phosphate|thymidine 5'-phosphate|deoxythymidine 5'-phosphate|5'-thymidylic acid|deoxythymidylic acid|thymidylate}} | ||
| + | {{#set: consumed by=DTMPKI-RXN|TPH}} | ||
| + | {{#set: produced by=THYMIDYLATESYN-RXN|RXN0-5107|RXN-14200|RXN-14213}} | ||
Revision as of 17:03, 10 January 2018
Contents
Metabolite TMP
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))
- inchi key:
- InChIKey=GYOZYWVXFNDGLU-XLPZGREQSA-L
- common name:
- dTMP
- molecular weight:
- 320.195
- Synonym(s):
- thymidylic acid
- thymidine monophosphate
- deoxythymidylate
- TMP
- thymidine 5'-monophosphate
- thymidine-phosphate
- thymidine 5'-phosphate
- deoxythymidine 5'-phosphate
- 5'-thymidylic acid
- deoxythymidylic acid
- thymidylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 365-07-1
- METABOLIGHTS : MTBLC63528
- PUBCHEM:
- HMDB : HMDB01227
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : dtmp
"CC1(=CN(C(=O)NC(=O)1)C2(CC(O)C(COP(=O)([O-])[O-])O2))" cannot be used as a page name in this wiki.
