Difference between revisions of "Tiso gene 2848"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9879 == * left end position: ** 129 * transcription direction: ** POSITIVE * right end position: ** 2597 * centisome position: ** 1.4334927...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] == * smiles: ** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9879 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15663 CPD-15663] ==
* left end position:
+
* smiles:
** 129
+
** CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J
* right end position:
+
* common name:
** 2597
+
** 2-trans-nonenoyl-CoA
* centisome position:
+
* molecular weight:
** 1.4334927    
+
** 901.711    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-nonenoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.4.11.21-RXN]]
+
== Reaction(s) known to produce the compound ==
** experimental_annotation
+
* [[RXN-14793]]
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=129}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193739 72193739]
{{#set: right end position=2597}}
+
* CHEBI:
{{#set: centisome position=1.4334927   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76292 76292]
{{#set: reaction associated=3.4.11.21-RXN}}
+
{{#set: smiles=CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J}}
 +
{{#set: common name=2-trans-nonenoyl-CoA}}
 +
{{#set: molecular weight=901.711   }}
 +
{{#set: common name=2E-nonenoyl-CoA}}
 +
{{#set: produced by=RXN-14793}}

Revision as of 18:03, 10 January 2018

Metabolite CPD-15663

  • smiles:
    • CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=HBLOTZDYPZAZLE-OWQWVSLFSA-J
  • common name:
    • 2-trans-nonenoyl-CoA
  • molecular weight:
    • 901.711
  • Synonym(s):
    • 2E-nonenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.