Difference between revisions of "Tiso gene 8226"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CHOLINE-KINASE-RXN CHOLINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** choline_e...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-HYDROXYPHENOL 2-OCTAPRENYL-6-HYDROXYPHENOL] == * smiles: ** CC(=CCCC(=CCCC(=CCCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OCTAPRENYL-6-HYDROXYPHENOL 2-OCTAPRENYL-6-HYDROXYPHENOL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** 3-(all-trans-octaprenyl)benzene-1,2-diol |
− | * | + | * molecular weight: |
− | ** | + | ** 655.058 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-octaprenyl-6-hydroxyphenol | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280833 5280833] |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.4444382.html 4444382] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1233 1233] |
− | + | * BIGG : 2ohph | |
− | * | + | * LIGAND-CPD: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05811 C05811] |
− | ** [http://www. | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N}} |
− | + | {{#set: common name=3-(all-trans-octaprenyl)benzene-1,2-diol}} | |
− | + | {{#set: molecular weight=655.058 }} | |
− | {{#set: | + | {{#set: common name=2-octaprenyl-6-hydroxyphenol}} |
− | {{#set: | + | {{#set: consumed by=2-OCTAPRENYL-6-OHPHENOL-METHY-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:03, 10 January 2018
Contents
Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(O)=C(O)C=CC=1))C)C)C)C)C)C)C)C
- inchi key:
- InChIKey=YNPGYMZVNLIZLD-BQFKTQOQSA-N
- common name:
- 3-(all-trans-octaprenyl)benzene-1,2-diol
- molecular weight:
- 655.058
- Synonym(s):
- 2-octaprenyl-6-hydroxyphenol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links