Difference between revisions of "PGCM"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-Phosphoserines Protein-Phosphoserines] == * common name: ** a protein L-serine phosphat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * inchi key: ** InChIKey=KWOLFJPFCHCOCG-UHFF...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == |
| + | * smiles: | ||
| + | ** CC(=O)C1(C=CC=CC=1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** acetophenone |
| + | * molecular weight: | ||
| + | ** 120.151 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** phenylmethylketone |
| + | ** methylphenylketone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-1302]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 98-86-2 |
| − | {{#set: common name= | + | * DRUGBANK : DB04619 |
| − | {{#set: consumed or produced by= | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410] | ||
| + | * HMDB : HMDB33910 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.7132.html 7132] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632] | ||
| + | {{#set: smiles=CC(=O)C1(C=CC=CC=1)}} | ||
| + | {{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=acetophenone}} | ||
| + | {{#set: molecular weight=120.151 }} | ||
| + | {{#set: common name=phenylmethylketone|methylphenylketone}} | ||
| + | {{#set: consumed or produced by=RXN-1302}} | ||
Revision as of 17:04, 10 January 2018
Contents
Metabolite PHENYL
- smiles:
- CC(=O)C1(C=CC=CC=1)
- inchi key:
- InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
- common name:
- acetophenone
- molecular weight:
- 120.151
- Synonym(s):
- phenylmethylketone
- methylphenylketone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 98-86-2
- DRUGBANK : DB04619
- PUBCHEM:
- HMDB : HMDB33910
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
