Difference between revisions of "CPD-8343"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11375 RXN-11375] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * inchi key: ** InChIKey=ACRWYXSKEHUQ...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11375 RXN-11375] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(#N)CCC1(C=CC=CC=1)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.5.1.23 EC-3.5.1.23]
+
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
 +
* common name:
 +
** 3-phenylpropionitrile
 +
* molecular weight:
 +
** 131.177   
 
* Synonym(s):
 
* Synonym(s):
 +
** benzenepropanenitrile
 +
** 2-phenylethyl cyanide
 +
** 3-phenylpropanonitril
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-18229]]
−
** 1 [[Ceramides]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Sphingoids]][c] '''+''' 1 [[Fatty-Acids]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a ceramide[c] '''+''' 1 H2O[c] '''=>''' 1 a sphingoid base[c] '''+''' 1 a fatty acid[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14341]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6483]], ceramide degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6483 PWY-6483]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-3.5.1.23}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
−
{{#set: gene associated=Tiso_gene_14341}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-6483}}
+
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
−
{{#set: reconstruction source=esiliculosus}}
+
* HMDB : HMDB34236
 +
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
 +
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
 +
{{#set: common name=3-phenylpropionitrile}}
 +
{{#set: molecular weight=131.177    }}
 +
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
 +
{{#set: consumed by=RXN-18229}}

Revision as of 17:04, 10 January 2018

Metabolite CPD-14673

  • smiles:
    • C(#N)CCC1(C=CC=CC=1)
  • inchi key:
    • InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
  • common name:
    • 3-phenylpropionitrile
  • molecular weight:
    • 131.177
  • Synonym(s):
    • benzenepropanenitrile
    • 2-phenylethyl cyanide
    • 3-phenylpropanonitril

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8343&oldid=15982"