Difference between revisions of "Tiso gene 13230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17893 RXN-17893] == * direction: ** LEFT-TO-RIGHT * common name: ** acylamino-acid-releasing_en...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O * i...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17893 RXN-17893] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13010 CPD-13010] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
 +
* inchi key:
 +
** InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
 
* common name:
 
* common name:
−
** acylamino-acid-releasing_enzyme
+
** 3'-monoiodothyronine
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.4.19.1 EC-3.4.19.1]
+
** 399.184   
 
* Synonym(s):
 
* Synonym(s):
 +
** L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
 +
** 3'-T1
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[N-Ac-L-methionyl-L-glutaminyl-Protein]][c] '''=>''' 1 [[CPD0-2015]][c] '''+''' 1 [[L-Glutaminyl-Peptides]][c]
+
* [[RXN-12037]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 an N-terminal Nα-acetyl-L-methionyl-L-glutaminyl-[protein][c] '''=>''' 1 Nα-acetyl-L-methionine[c] '''+''' 1 an N-terminal L-glutaminyl-[protein][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3550]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY-7799]], Arg/N-end rule pathway (eukaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7799 PWY-7799]
+
−
** '''8''' reactions found over '''14''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=acylamino-acid-releasing_enzyme}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986170 50986170]
−
{{#set: ec number=EC-3.4.19.1}}
+
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O}}
−
{{#set: gene associated=Tiso_gene_3550}}
+
{{#set: inchi key=InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N}}
−
{{#set: in pathway=PWY-7799}}
+
{{#set: common name=3'-monoiodothyronine}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=399.184    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=L-tyrosine, O-(4-hydroxy-3-iodophenyl)-|3'-T1}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: produced by=RXN-12037}}

Revision as of 17:04, 10 January 2018

Metabolite CPD-13010

  • smiles:
    • C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O
  • inchi key:
    • InChIKey=RUIUIJSMLKJUDC-ZDUSSCGKSA-N
  • common name:
    • 3'-monoiodothyronine
  • molecular weight:
    • 399.184
  • Synonym(s):
    • L-tyrosine, O-(4-hydroxy-3-iodophenyl)-
    • 3'-T1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C=C2)O)))[N+])([O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_13230&oldid=15985"