Difference between revisions of "R01752"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16455 == * Synonym(s): == Reactions associated == * RXN-8443 ** pantograph-athaliana ** pantograph-esiliculosus == Pat...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] == * smiles: ** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_16455 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXY-CTP 5-HYDROXY-CTP] ==
 +
* smiles:
 +
** C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
 +
* inchi key:
 +
** InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
 +
* common name:
 +
** 5-hydroxy-CTP
 +
* molecular weight:
 +
** 495.126   
 
* Synonym(s):
 
* Synonym(s):
 +
** 5-hydroxycytidine triphosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[RXN-8443]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[athaliana]]
+
* [[RXN0-7080]]
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-5381]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=RXN-8443}}
+
* PUBCHEM:
{{#set: pathway associated=PWY-5381}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202584 25202584]
 +
{{#set: smiles=C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O}}
 +
{{#set: inchi key=InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J}}
 +
{{#set: common name=5-hydroxy-CTP}}
 +
{{#set: molecular weight=495.126    }}
 +
{{#set: common name=5-hydroxycytidine triphosphate}}
 +
{{#set: produced by=RXN0-7080}}

Revision as of 17:04, 10 January 2018

Metabolite 5-HYDROXY-CTP

  • smiles:
    • C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O
  • inchi key:
    • InChIKey=DMFODUNDODUQKK-UAKXSSHOSA-J
  • common name:
    • 5-hydroxy-CTP
  • molecular weight:
    • 495.126
  • Synonym(s):
    • 5-hydroxycytidine triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(C(C(O)C(N1(C(N=C(C(O)=C1)N)=O))O2)O))OP(OP(OP([O-])([O-])=O)([O-])=O)([O-])=O" cannot be used as a page name in this wiki.