Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"

Revision as of 17:05, 10 January 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2353 CPD0-2353] ==
-* smiles:
-** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J
 * common name:
-** 2-trans, 4-cis-undecadienoyl-CoA
+** a tRNA precursor with a short 3' extension
-* molecular weight:
-** 927.749
 * Synonym(s):
-** 2E, 4Z-undecadienoyl-CoA
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-14775]]
+* [[3.1.26.5-RXN]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a tRNA precursor with a short 3' extension}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658228 90658228]
+{{#set: produced by=3.1.26.5-RXN}}
-{{#set: smiles=CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
-{{#set: inchi key=InChIKey=SZKPLUULGGERFD-NFPSBOAPSA-J}}
-{{#set: common name=2-trans, 4-cis-undecadienoyl-CoA}}
-{{#set: molecular weight=927.749    }}
-{{#set: common name=2E, 4Z-undecadienoyl-CoA}}
-{{#set: produced by=RXN-14775}}