Difference between revisions of "G3PD3"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-170 CPD-170] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OCC4(C(O)C(O)C(O)C(OCC3(C(O)C(O)C(O)C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == * smiles: ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-226 CPD-226] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J |
* common name: | * common name: | ||
− | ** | + | ** vinylacetyl-CoA |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 831.577 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-butenoyl-CoA |
− | ** | + | ** but-3-enoyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]] |
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266616 45266616] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57396 57396] |
− | {{#set: smiles=C(O) | + | * LIGAND-CPD: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02331 C02331] |
− | {{#set: common name= | + | {{#set: smiles=C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J}} |
− | {{#set: common name= | + | {{#set: common name=vinylacetyl-CoA}} |
− | + | {{#set: molecular weight=831.577 }} | |
− | {{#set: consumed or produced by= | + | {{#set: common name=3-butenoyl-CoA|but-3-enoyl-CoA}} |
+ | {{#set: consumed or produced by=VINYLACETYL-COA-DELTA-ISOMERASE-RXN}} |
Revision as of 17:06, 10 January 2018
Contents
Metabolite CPD-226
- smiles:
- C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- inchi key:
- InChIKey=UATIGEHITDTAGF-CITAKDKDSA-J
- common name:
- vinylacetyl-CoA
- molecular weight:
- 831.577
- Synonym(s):
- 3-butenoyl-CoA
- but-3-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.