Difference between revisions of "Cis-21-CP-39-keto-40-Me-C60-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_608 == * left end position: ** 87 * transcription direction: ** POSITIVE * right end position: ** 243 * centisome position: ** 0.28049132...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_608 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] ==
−
* left end position:
+
* smiles:
−
** 87
+
** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
−
* right end position:
+
* common name:
−
** 243
+
** (7Z)-tetradecenoyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 0.28049132    
+
** 971.845    
 
* Synonym(s):
 
* Synonym(s):
 +
** 14:1-Δ7-CoA
 +
** cis-7-tetradecenoyl-CoA
 +
** 14:1(n-7)-CoA
 +
** (7Z)-tetradec-7-enoyl-CoA
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.26.3-RXN]]
+
* [[RXN-17792]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
* [[RXN-17791]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=87}}
+
{{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: transcription direction=POSITIVE}}
+
{{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}}
−
{{#set: right end position=243}}
+
{{#set: common name=(7Z)-tetradecenoyl-CoA}}
−
{{#set: centisome position=0.28049132   }}
+
{{#set: molecular weight=971.845   }}
−
{{#set: reaction associated=3.1.26.3-RXN}}
+
{{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}}
 +
{{#set: consumed by=RXN-17792}}
 +
{{#set: produced by=RXN-17791}}

Revision as of 17:07, 10 January 2018

Metabolite CPD-19147

  • smiles:
    • CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
  • common name:
    • (7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 971.845
  • Synonym(s):
    • 14:1-Δ7-CoA
    • cis-7-tetradecenoyl-CoA
    • 14:1(n-7)-CoA
    • (7Z)-tetradec-7-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-21-CP-39-keto-40-Me-C60-ACPs&oldid=16256"