Difference between revisions of "UDPACYLGLCNACDEACETYL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12305 RXN-12305] == * direction: ** LEFT-TO-RIGHT * common name: ** Probable 1,4-beta-D-glucan...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-713 CPD-713] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12305 RXN-12305] ==
* smiles:
+
* direction:
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N
+
 
* common name:
 
* common name:
** 6-oxocampestanol
+
** Probable 1,4-beta-D-glucan cellobiohydrolase C
* molecular weight:
+
* ec number:
** 416.686   
+
** [http://enzyme.expasy.org/EC/3.2.1.91 EC-3.2.1.91]
 
* Synonym(s):
 
* Synonym(s):
** oxocampestanol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-715]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-13205]][c] '''+''' 1 [[WATER]][c] '''=>''' 2 [[CELLOBIOSE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 cellotetraose[c] '''+''' 1 H2O[c] '''=>''' 2 β-D-cellobiose[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2906]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061347 16061347]
+
{{#set: common name=Probable 1,4-beta-D-glucan cellobiohydrolase C}}
* CHEBI:
+
{{#set: ec number=EC-3.2.1.91}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20747 20747]
+
{{#set: gene associated=Tiso_gene_2906}}
* LIGAND-CPD:
+
{{#set: in pathway=}}
** [http://www.genome.jp/dbget-bin/www_bget?C15789 C15789]
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=NBJZGNFIZZWBOJ-JSHJXQBASA-N}}
+
{{#set: reconstruction source=experimental_annotation}}
{{#set: common name=6-oxocampestanol}}
+
{{#set: molecular weight=416.686    }}
+
{{#set: common name=oxocampestanol}}
+
{{#set: consumed by=RXN-715}}
+

Revision as of 17:08, 10 January 2018

Reaction RXN-12305

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Probable 1,4-beta-D-glucan cellobiohydrolase C
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 cellotetraose[c] + 1 H2O[c] => 2 β-D-cellobiose[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links